657-84-1
| Name | Sodium p-toluenesulfonate |
| CAS | 657-84-1 |
| EINECS(EC#) | 211-522-5 |
| Molecular Formula | C7H7NaO3S |
| MDL Number | MFCD00064388 |
| Molecular Weight | 194.18 |
| MOL File | 657-84-1.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | >300°C |
| Boiling point | 400℃[at 101 325 Pa] |
| density | 1.55 g/cm3 (20℃) |
| vapor pressure | <1 hPa (20 °C) |
| Fp | 500 °C |
| storage temp. | Store below +30°C. |
| solubility | 818g/l soluble |
| form | Powder |
| pka | 6.59[at 20 ℃] |
| color | White to off-white |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | soluble |
| Merck | 9533 |
| BRN | 3637479 |
| Cosmetics Ingredients Functions | SURFACTANT - CLEANSING SURFACTANT - HYDROTROPE |
| InChI | 1S/C7H8O3S.Na/c1-6-2-4-7(5-3-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | KVCGISUBCHHTDD-UHFFFAOYSA-M |
| SMILES | [Na+].Cc1ccc(cc1)S([O-])(=O)=O |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| RTECS | XT7350000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29041000 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 657-84-1(Hazardous Substances Data) |